C28H40I2Si — CID 58992262
3,7-diiodo-5,5-dioctylbenzo[b][1]benzosilole (PubChem CID 58992262) has the molecular formula C28H40I2Si and a molecular weight of 658.52 g/mol. Its IUPAC name is 3,7-diiodo-5,5-dioctylbenzo[b][1]benzosilole.
| Compound Name | 3,7-diiodo-5,5-dioctylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 58992262 |
| Molecular Formula | C28H40I2Si |
| Molecular Weight | 658.52 g/mol |
| Exact Mass | 658.10 |
| IUPAC Name | 3,7-diiodo-5,5-dioctylbenzo[b][1]benzosilole |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(I)ccc2-c2ccc(I)cc21 |
| InChI | InChI=1S/C28H40I2Si/c1-3-5-7-9-11-13-19-31(20-14-12-10-8-6-4-2)27-21-23(29)15-17-25(27)26-18-16-24(30)22-28(26)31/h15-18,21-22H,3-14,19-20H2,1-2H3 |
| InChIKey | YJXFXCUERZGTRA-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.52 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|