C39H50Br2S2Si — CID 123709589
2-bromo-5-[3-(5-bromo-4-hexylthiophen-2-yl)-5,5-dihexylbenzo[b][1]benzosilol-7-yl]-3-methylthiophene (PubChem CID 123709589) has the molecular formula C39H50Br2S2Si and a molecular weight of 770.86 g/mol. Its IUPAC name is 2-bromo-5-[3-(5-bromo-4-hexylthiophen-2-yl)-5,5-dihexylbenzo[b][1]benzosilol-7-yl]-3-methylthiophene.
| Compound Name | 2-bromo-5-[3-(5-bromo-4-hexylthiophen-2-yl)-5,5-dihexylbenzo[b][1]benzosilol-7-yl]-3-methylthiophene |
|---|---|
| PubChem CID | 123709589 |
| Molecular Formula | C39H50Br2S2Si |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 768.15 |
| IUPAC Name | 2-bromo-5-[3-(5-bromo-4-hexylthiophen-2-yl)-5,5-dihexylbenzo[b][1]benzosilol-7-yl]-3-methylthiophene |
| SMILES | CCCCCCc1cc(-c2ccc3c(c2)[Si](CCCCCC)(CCCCCC)c2cc(-c4cc(C)c(Br)s4)ccc2-3)sc1Br |
| InChI | InChI=1S/C39H50Br2S2Si/c1-5-8-11-14-17-31-25-35(43-39(31)41)30-19-21-33-32-20-18-29(34-24-28(4)38(40)42-34)26-36(32)44(37(33)27-30,22-15-12-9-6-2)23-16-13-10-7-3/h18-21,24-27H,5-17,22-23H2,1-4H3 |
| InChIKey | LJVVKICXBOBENV-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|