C19H27BrO3SSi — CID 59244133
[4-(5-bromo-4-hexylthiophen-2-yl)phenyl]-trimethoxysilane (PubChem CID 59244133) has the molecular formula C19H27BrO3SSi and a molecular weight of 443.48 g/mol. Its IUPAC name is [4-(5-bromo-4-hexylthiophen-2-yl)phenyl]-trimethoxysilane.
| Compound Name | [4-(5-bromo-4-hexylthiophen-2-yl)phenyl]-trimethoxysilane |
|---|---|
| PubChem CID | 59244133 |
| Molecular Formula | C19H27BrO3SSi |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | [4-(5-bromo-4-hexylthiophen-2-yl)phenyl]-trimethoxysilane |
| SMILES | CCCCCCc1cc(-c2ccc([Si](OC)(OC)OC)cc2)sc1Br |
| InChI | InChI=1S/C19H27BrO3SSi/c1-5-6-7-8-9-16-14-18(24-19(16)20)15-10-12-17(13-11-15)25(21-2,22-3)23-4/h10-14H,5-9H2,1-4H3 |
| InChIKey | WWSMUBQYTBZUKL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|