C25H29Br2N3S2 — CID 132601077
4,6-bis(5-bromo-4-hexylthiophen-2-yl)pyrimidine-2-carbonitrile (PubChem CID 132601077) has the molecular formula C25H29Br2N3S2 and a molecular weight of 595.47 g/mol. Its IUPAC name is 4,6-bis(5-bromo-4-hexylthiophen-2-yl)pyrimidine-2-carbonitrile.
| Compound Name | 4,6-bis(5-bromo-4-hexylthiophen-2-yl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 132601077 |
| Molecular Formula | C25H29Br2N3S2 |
| Molecular Weight | 595.47 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | 4,6-bis(5-bromo-4-hexylthiophen-2-yl)pyrimidine-2-carbonitrile |
| SMILES | CCCCCCc1cc(-c2cc(-c3cc(CCCCCC)c(Br)s3)nc(C#N)n2)sc1Br |
| InChI | InChI=1S/C25H29Br2N3S2/c1-3-5-7-9-11-17-13-21(31-24(17)26)19-15-20(30-23(16-28)29-19)22-14-18(25(27)32-22)12-10-8-6-4-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | HJVHJSQGZYHSGX-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.47 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|