C14H15Br2IS2 — CID 132549369
2-bromo-3-(5-bromo-4-hexylthiophen-2-yl)-5-iodothiophene (PubChem CID 132549369) has the molecular formula C14H15Br2IS2 and a molecular weight of 534.12 g/mol. Its IUPAC name is 2-bromo-3-(5-bromo-4-hexylthiophen-2-yl)-5-iodothiophene.
| Compound Name | 2-bromo-3-(5-bromo-4-hexylthiophen-2-yl)-5-iodothiophene |
|---|---|
| PubChem CID | 132549369 |
| Molecular Formula | C14H15Br2IS2 |
| Molecular Weight | 534.12 g/mol |
| Exact Mass | 531.80 |
| IUPAC Name | 2-bromo-3-(5-bromo-4-hexylthiophen-2-yl)-5-iodothiophene |
| SMILES | CCCCCCc1cc(-c2cc(I)sc2Br)sc1Br |
| InChI | InChI=1S/C14H15Br2IS2/c1-2-3-4-5-6-9-7-11(18-13(9)15)10-8-12(17)19-14(10)16/h7-8H,2-6H2,1H3 |
| InChIKey | OVYYUDQLUYPIFN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.12 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|