C47H54O3S2Si — CID 59027262
[4-[4-[5-[5-[3,5-diethyl-4-(4-octylphenyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]phenyl]-trimethoxysilane (PubChem CID 59027262) has the molecular formula C47H54O3S2Si and a molecular weight of 759.17 g/mol. Its IUPAC name is [4-[4-[5-[5-[3,5-diethyl-4-(4-octylphenyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]phenyl]-trimethoxysilane.
| Compound Name | [4-[4-[5-[5-[3,5-diethyl-4-(4-octylphenyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]phenyl]-trimethoxysilane |
|---|---|
| PubChem CID | 59027262 |
| Molecular Formula | C47H54O3S2Si |
| Molecular Weight | 759.17 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | [4-[4-[5-[5-[3,5-diethyl-4-(4-octylphenyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]phenyl]-trimethoxysilane |
| SMILES | CCCCCCCCc1ccc(-c2c(CC)cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc([Si](OC)(OC)OC)cc6)cc5)s4)s3)cc2CC)cc1 |
| InChI | InChI=1S/C47H54O3S2Si/c1-7-10-11-12-13-14-15-34-16-18-40(19-17-34)47-35(8-2)32-41(33-36(47)9-3)44-29-31-46(52-44)45-30-28-43(51-45)39-22-20-37(21-23-39)38-24-26-42(27-25-38)53(48-4,49-5)50-6/h16-33H,7-15H2,1-6H3 |
| InChIKey | OGPHNOXAYGBGDG-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.17 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|