About 2-dodecyl-4-iodoaniline
2-dodecyl-4-iodoaniline (PubChem CID 139793987) has the molecular formula C18H30IN
and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-dodecyl-4-iodoaniline.
Molecular Properties
| Compound Name | 2-dodecyl-4-iodoaniline |
| PubChem CID | 139793987 |
| Molecular Formula | C18H30IN |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-dodecyl-4-iodoaniline |
| SMILES | CCCCCCCCCCCCc1cc(I)ccc1N |
| InChI | InChI=1S/C18H30IN/c1-2-3-4-5-6-7-8-9-10-11-12-16-15-17(19)13-14-18(16)20/h13-15H,2-12,20H2,1H3 |
| InChIKey | WSEBTOSSRHSEAH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecyl-4-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecyl-4-iodoaniline?
The IUPAC name of 2-dodecyl-4-iodoaniline (CID 139793987) is 2-dodecyl-4-iodoaniline.
What is the SMILES notation for 2-dodecyl-4-iodoaniline?
The canonical SMILES for 2-dodecyl-4-iodoaniline is CCCCCCCCCCCCc1cc(I)ccc1N.
What is the InChIKey of 2-dodecyl-4-iodoaniline?
The InChIKey is WSEBTOSSRHSEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30IN/c1-2-3-4-5-6-7-8-9-10-11-12-16-15-17(19)13-14-18(16)20/h13-15H,2-12,20H2,1H3.
What are the key properties of 2-dodecyl-4-iodoaniline?
2-dodecyl-4-iodoaniline has a molecular weight of 387.35 g/mol, XLogP of 6.34, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecyl-4-iodoaniline is sourced from PubChem (CID 139793987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).