C9H10BrIO2 — CID 64787018
1-bromo-4-(iodomethyl)-2,5-dimethoxybenzene (PubChem CID 64787018) has the molecular formula C9H10BrIO2 and a molecular weight of 356.99 g/mol. Its IUPAC name is 1-bromo-4-(iodomethyl)-2,5-dimethoxybenzene.
| Compound Name | 1-bromo-4-(iodomethyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 64787018 |
| Molecular Formula | C9H10BrIO2 |
| Molecular Weight | 356.99 g/mol |
| Exact Mass | 355.89 |
| IUPAC Name | 1-bromo-4-(iodomethyl)-2,5-dimethoxybenzene |
| SMILES | COc1cc(CI)c(OC)cc1Br |
| InChI | InChI=1S/C9H10BrIO2/c1-12-8-4-7(10)9(13-2)3-6(8)5-11/h3-4H,5H2,1-2H3 |
| InChIKey | ZARABAZTBNOQIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|