C10H14BrNO4 — CID 167477101
1-amino-2-(4-bromo-2,5-dimethoxyphenyl)ethane-1,1-diol (PubChem CID 167477101) has the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. Its IUPAC name is 1-amino-2-(4-bromo-2,5-dimethoxyphenyl)ethane-1,1-diol.
| Compound Name | 1-amino-2-(4-bromo-2,5-dimethoxyphenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 167477101 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-amino-2-(4-bromo-2,5-dimethoxyphenyl)ethane-1,1-diol |
| SMILES | COc1cc(CC(N)(O)O)c(OC)cc1Br |
| InChI | InChI=1S/C10H14BrNO4/c1-15-8-4-7(11)9(16-2)3-6(8)5-10(12,13)14/h3-4,13-14H,5,12H2,1-2H3 |
| InChIKey | YOMXAGOJMZTUPF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|