C12H19NO5S — CID 171534528
1-amino-2-(4-ethylsulfinyl-2,5-dimethoxyphenyl)ethane-1,1-diol (PubChem CID 171534528) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-amino-2-(4-ethylsulfinyl-2,5-dimethoxyphenyl)ethane-1,1-diol.
| Compound Name | 1-amino-2-(4-ethylsulfinyl-2,5-dimethoxyphenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 171534528 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-amino-2-(4-ethylsulfinyl-2,5-dimethoxyphenyl)ethane-1,1-diol |
| SMILES | CCS(=O)c1cc(OC)c(CC(N)(O)O)cc1OC |
| InChI | InChI=1S/C12H19NO5S/c1-4-19(16)11-6-9(17-2)8(5-10(11)18-3)7-12(13,14)15/h5-6,14-15H,4,7,13H2,1-3H3 |
| InChIKey | BEJVOLUISZGJMZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|