C13H21NO4S — CID 171534622
3-[4-(2-aminoethyl)-2,5-dimethoxyphenyl]sulfinylpropan-1-ol (PubChem CID 171534622) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-2,5-dimethoxyphenyl]sulfinylpropan-1-ol.
| Compound Name | 3-[4-(2-aminoethyl)-2,5-dimethoxyphenyl]sulfinylpropan-1-ol |
|---|---|
| PubChem CID | 171534622 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[4-(2-aminoethyl)-2,5-dimethoxyphenyl]sulfinylpropan-1-ol |
| SMILES | COc1cc(S(=O)CCCO)c(OC)cc1CCN |
| InChI | InChI=1S/C13H21NO4S/c1-17-11-9-13(19(16)7-3-6-15)12(18-2)8-10(11)4-5-14/h8-9,15H,3-7,14H2,1-2H3 |
| InChIKey | FVYYKLIHEUCDFL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |