C13H21NO5S — CID 171534569
1-amino-2-(2,5-dimethoxy-4-propylsulfinylphenyl)ethane-1,1-diol (PubChem CID 171534569) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-amino-2-(2,5-dimethoxy-4-propylsulfinylphenyl)ethane-1,1-diol.
| Compound Name | 1-amino-2-(2,5-dimethoxy-4-propylsulfinylphenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 171534569 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-amino-2-(2,5-dimethoxy-4-propylsulfinylphenyl)ethane-1,1-diol |
| SMILES | CCCS(=O)c1cc(OC)c(CC(N)(O)O)cc1OC |
| InChI | InChI=1S/C13H21NO5S/c1-4-5-20(17)12-7-10(18-2)9(6-11(12)19-3)8-13(14,15)16/h6-7,15-16H,4-5,8,14H2,1-3H3 |
| InChIKey | HIEMPGJUQHUBSZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|