C14H23NO6S — CID 171534627
1-amino-2-(4-butylsulfonyl-2,5-dimethoxyphenyl)ethane-1,1-diol (PubChem CID 171534627) has the molecular formula C14H23NO6S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-amino-2-(4-butylsulfonyl-2,5-dimethoxyphenyl)ethane-1,1-diol.
| Compound Name | 1-amino-2-(4-butylsulfonyl-2,5-dimethoxyphenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 171534627 |
| Molecular Formula | C14H23NO6S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-amino-2-(4-butylsulfonyl-2,5-dimethoxyphenyl)ethane-1,1-diol |
| SMILES | CCCCS(=O)(=O)c1cc(OC)c(CC(N)(O)O)cc1OC |
| InChI | InChI=1S/C14H23NO6S/c1-4-5-6-22(18,19)13-8-11(20-2)10(7-12(13)21-3)9-14(15,16)17/h7-8,16-17H,4-6,9,15H2,1-3H3 |
| InChIKey | YDIWUDKXZZNWPT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|