C16H25F2NO4S — CID 171534666
2-[4-(1,1-difluorohexylsulfonyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 171534666) has the molecular formula C16H25F2NO4S and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[4-(1,1-difluorohexylsulfonyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(1,1-difluorohexylsulfonyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 171534666 |
| Molecular Formula | C16H25F2NO4S |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[4-(1,1-difluorohexylsulfonyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | CCCCCC(F)(F)S(=O)(=O)c1cc(OC)c(CCN)cc1OC |
| InChI | InChI=1S/C16H25F2NO4S/c1-4-5-6-8-16(17,18)24(20,21)15-11-13(22-2)12(7-9-19)10-14(15)23-3/h10-11H,4-9,19H2,1-3H3 |
| InChIKey | NHGCXIGEZFSKSR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|