C14H17F6NO2 — CID 169149363
2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 169149363) has the molecular formula C14H17F6NO2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 169149363 |
| Molecular Formula | C14H17F6NO2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc(C(C)(C(F)(F)F)C(F)(F)F)c(OC)cc1CCN |
| InChI | InChI=1S/C14H17F6NO2/c1-12(13(15,16)17,14(18,19)20)9-7-10(22-2)8(4-5-21)6-11(9)23-3/h6-7H,4-5,21H2,1-3H3 |
| InChIKey | JSNTWOBBOLNWPZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |