About 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline
4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline (PubChem CID 171534600) has the molecular formula C14H22F2N2O2
and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline |
| PubChem CID | 171534600 |
| Molecular Formula | C14H22F2N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline |
| SMILES | COc1cc(N(CCF)CCF)c(OC)cc1CCN |
| InChI | InChI=1S/C14H22F2N2O2/c1-19-13-10-12(18(7-4-15)8-5-16)14(20-2)9-11(13)3-6-17/h9-10H,3-8,17H2,1-2H3 |
| InChIKey | KZSFEHKUHRLHSP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline?
The IUPAC name of 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline (CID 171534600) is 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline.
What is the SMILES notation for 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline?
The canonical SMILES for 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline is COc1cc(N(CCF)CCF)c(OC)cc1CCN.
What is the InChIKey of 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline?
The InChIKey is KZSFEHKUHRLHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2O2/c1-19-13-10-12(18(7-4-15)8-5-16)14(20-2)9-11(13)3-6-17/h9-10H,3-8,17H2,1-2H3.
What are the key properties of 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline?
4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline has a molecular weight of 288.34 g/mol, XLogP of 1.95, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-N,N-bis(2-fluoroethyl)-2,5-dimethoxyaniline is sourced from PubChem (CID 171534600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).