C12H18FNO2S2 — CID 171534578
2-[4-(2-fluoroethyldisulfanyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 171534578) has the molecular formula C12H18FNO2S2 and a molecular weight of 291.41 g/mol. Its IUPAC name is 2-[4-(2-fluoroethyldisulfanyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(2-fluoroethyldisulfanyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 171534578 |
| Molecular Formula | C12H18FNO2S2 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[4-(2-fluoroethyldisulfanyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc(SSCCF)c(OC)cc1CCN |
| InChI | InChI=1S/C12H18FNO2S2/c1-15-10-8-12(18-17-6-4-13)11(16-2)7-9(10)3-5-14/h7-8H,3-6,14H2,1-2H3 |
| InChIKey | KVHPWWKRJZTHEH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|