C14H22FNO2S — CID 162733833
2-[4-(3-fluorobutylsulfanyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 162733833) has the molecular formula C14H22FNO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[4-(3-fluorobutylsulfanyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(3-fluorobutylsulfanyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 162733833 |
| Molecular Formula | C14H22FNO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-[4-(3-fluorobutylsulfanyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc(SCCC(C)F)c(OC)cc1CCN |
| InChI | InChI=1S/C14H22FNO2S/c1-10(15)5-7-19-14-9-12(17-2)11(4-6-16)8-13(14)18-3/h8-10H,4-7,16H2,1-3H3 |
| InChIKey | CWUYYDPQNSHIMS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |