C13H17NO2S — CID 169149320
2-(2,5-dimethoxy-4-prop-2-ynylsulfanylphenyl)ethanamine (PubChem CID 169149320) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-prop-2-ynylsulfanylphenyl)ethanamine.
| Compound Name | 2-(2,5-dimethoxy-4-prop-2-ynylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 169149320 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(2,5-dimethoxy-4-prop-2-ynylsulfanylphenyl)ethanamine |
| SMILES | C#CCSc1cc(OC)c(CCN)cc1OC |
| InChI | InChI=1S/C13H17NO2S/c1-4-7-17-13-9-11(15-2)10(5-6-14)8-12(13)16-3/h1,8-9H,5-7,14H2,2-3H3 |
| InChIKey | BWTBPZDUQOTNBE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|