C12H16ClNO2 — CID 76967015
2-(4-ethynyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride (PubChem CID 76967015) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(4-ethynyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | 2-(4-ethynyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 76967015 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(4-ethynyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride |
| SMILES | C#Cc1cc(OC)c(CCN)cc1OC.Cl |
| InChI | InChI=1S/C12H15NO2.ClH/c1-4-9-7-12(15-3)10(5-6-13)8-11(9)14-2;/h1,7-8H,5-6,13H2,2-3H3;1H |
| InChIKey | AKGLSSGVCLTMIM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|