C13H15F6NO2Se — CID 171534553
2-[4-(1,1,1,3,3,3-hexafluoropropan-2-ylselanyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 171534553) has the molecular formula C13H15F6NO2Se and a molecular weight of 410.22 g/mol. Its IUPAC name is 2-[4-(1,1,1,3,3,3-hexafluoropropan-2-ylselanyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(1,1,1,3,3,3-hexafluoropropan-2-ylselanyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 171534553 |
| Molecular Formula | C13H15F6NO2Se |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 2-[4-(1,1,1,3,3,3-hexafluoropropan-2-ylselanyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc([Se]C(C(F)(F)F)C(F)(F)F)c(OC)cc1CCN |
| InChI | InChI=1S/C13H15F6NO2Se/c1-21-8-6-10(9(22-2)5-7(8)3-4-20)23-11(12(14,15)16)13(17,18)19/h5-6,11H,3-4,20H2,1-2H3 |
| InChIKey | NFMLXVFQNXPBKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|