C12H17F2NO2Se — CID 171534515
2-[4-(2,2-difluoroethylselanyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 171534515) has the molecular formula C12H17F2NO2Se and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethylselanyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(2,2-difluoroethylselanyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 171534515 |
| Molecular Formula | C12H17F2NO2Se |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[4-(2,2-difluoroethylselanyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc([Se]CC(F)F)c(OC)cc1CCN |
| InChI | InChI=1S/C12H17F2NO2Se/c1-16-9-6-11(18-7-12(13)14)10(17-2)5-8(9)3-4-15/h5-6,12H,3-4,7,15H2,1-2H3 |
| InChIKey | HGBZNMZDOUTUSL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|