C13H20FNO2 — CID 117355471
3-[4-(1-fluoroethyl)-2,5-dimethoxyphenyl]propan-1-amine (PubChem CID 117355471) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-[4-(1-fluoroethyl)-2,5-dimethoxyphenyl]propan-1-amine.
| Compound Name | 3-[4-(1-fluoroethyl)-2,5-dimethoxyphenyl]propan-1-amine |
|---|---|
| PubChem CID | 117355471 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-[4-(1-fluoroethyl)-2,5-dimethoxyphenyl]propan-1-amine |
| SMILES | COc1cc(C(C)F)c(OC)cc1CCCN |
| InChI | InChI=1S/C13H20FNO2/c1-9(14)11-8-12(16-2)10(5-4-6-15)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3 |
| InChIKey | YVMKMWTZWQIPOC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |