C15H19F2NO2S — CID 169149410
2-[4-(1,1-difluoropent-4-ynylsulfanyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 169149410) has the molecular formula C15H19F2NO2S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[4-(1,1-difluoropent-4-ynylsulfanyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(1,1-difluoropent-4-ynylsulfanyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 169149410 |
| Molecular Formula | C15H19F2NO2S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[4-(1,1-difluoropent-4-ynylsulfanyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | C#CCCC(F)(F)Sc1cc(OC)c(CCN)cc1OC |
| InChI | InChI=1S/C15H19F2NO2S/c1-4-5-7-15(16,17)21-14-10-12(19-2)11(6-8-18)9-13(14)20-3/h1,9-10H,5-8,18H2,2-3H3 |
| InChIKey | IDHKLHRFSYGUFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|