C10H12F3NO2S — CID 81207515
3-methoxy-4-(3,3,3-trifluoropropylsulfinyl)aniline (PubChem CID 81207515) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 3-methoxy-4-(3,3,3-trifluoropropylsulfinyl)aniline.
| Compound Name | 3-methoxy-4-(3,3,3-trifluoropropylsulfinyl)aniline |
|---|---|
| PubChem CID | 81207515 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-methoxy-4-(3,3,3-trifluoropropylsulfinyl)aniline |
| SMILES | COc1cc(N)ccc1S(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2S/c1-16-8-6-7(14)2-3-9(8)17(15)5-4-10(11,12)13/h2-3,6H,4-5,14H2,1H3 |
| InChIKey | BASWCOYLBBQUBX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|