C16H15BrFIO2 — CID 118518081
1-bromo-5-[[2-fluoro-3-(iodomethyl)phenyl]methyl]-2,4-dimethoxybenzene (PubChem CID 118518081) has the molecular formula C16H15BrFIO2 and a molecular weight of 465.10 g/mol. Its IUPAC name is 1-bromo-5-[[2-fluoro-3-(iodomethyl)phenyl]methyl]-2,4-dimethoxybenzene.
| Compound Name | 1-bromo-5-[[2-fluoro-3-(iodomethyl)phenyl]methyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 118518081 |
| Molecular Formula | C16H15BrFIO2 |
| Molecular Weight | 465.10 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | 1-bromo-5-[[2-fluoro-3-(iodomethyl)phenyl]methyl]-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(Cc2cccc(CI)c2F)cc1Br |
| InChI | InChI=1S/C16H15BrFIO2/c1-20-14-8-15(21-2)13(17)7-12(14)6-10-4-3-5-11(9-19)16(10)18/h3-5,7-8H,6,9H2,1-2H3 |
| InChIKey | DJIYZERTNDXTPR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.10 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|