C20H20ClFO5 — CID 24809654
ethyl 3-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-3-oxopropanoate (PubChem CID 24809654) has the molecular formula C20H20ClFO5 and a molecular weight of 394.83 g/mol. Its IUPAC name is ethyl 3-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 24809654 |
| Molecular Formula | C20H20ClFO5 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 3-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(Cc2cccc(Cl)c2F)c(OC)cc1OC |
| InChI | InChI=1S/C20H20ClFO5/c1-4-27-19(24)10-16(23)14-9-13(17(25-2)11-18(14)26-3)8-12-6-5-7-15(21)20(12)22/h5-7,9,11H,4,8,10H2,1-3H3 |
| InChIKey | ZTWBZORDUMKEDE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|