C16H15ClF2O3 — CID 163997876
[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-methoxymethanol (PubChem CID 163997876) has the molecular formula C16H15ClF2O3 and a molecular weight of 328.74 g/mol. Its IUPAC name is [5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-methoxymethanol.
| Compound Name | [5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-methoxymethanol |
|---|---|
| PubChem CID | 163997876 |
| Molecular Formula | C16H15ClF2O3 |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-methoxymethanol |
| SMILES | COc1cc(F)c(C(O)OC)cc1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C16H15ClF2O3/c1-21-14-8-13(18)11(16(20)22-2)7-10(14)6-9-4-3-5-12(17)15(9)19/h3-5,7-8,16,20H,6H2,1-2H3 |
| InChIKey | UGHYRWJDXSJGQA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|