C22H24ClF2NO4 — CID 143535268
ethyl 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxybenzoyl]prop-2-enoate;N-methylmethanamine (PubChem CID 143535268) has the molecular formula C22H24ClF2NO4 and a molecular weight of 439.89 g/mol. Its IUPAC name is ethyl 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxybenzoyl]prop-2-enoate;N-methylmethanamine.
| Compound Name | ethyl 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxybenzoyl]prop-2-enoate;N-methylmethanamine |
|---|---|
| PubChem CID | 143535268 |
| Molecular Formula | C22H24ClF2NO4 |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxybenzoyl]prop-2-enoate;N-methylmethanamine |
| SMILES | C=C(C(=O)OCC)C(=O)c1cc(Cc2cccc(Cl)c2F)c(OC)cc1F.CNC |
| InChI | InChI=1S/C20H17ClF2O4.C2H7N/c1-4-27-20(25)11(2)19(24)14-9-13(17(26-3)10-16(14)22)8-12-6-5-7-15(21)18(12)23;1-3-2/h5-7,9-10H,2,4,8H2,1,3H3;3H,1-2H3 |
| InChIKey | UBUGUDIVEIKZLJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|