C27H32ClFO6 — CID 91258947
ethyl (5S)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-5-(hydroxymethyl)-6-methylhept-2-enoate (PubChem CID 91258947) has the molecular formula C27H32ClFO6 and a molecular weight of 507.00 g/mol. Its IUPAC name is ethyl (5S)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-5-(hydroxymethyl)-6-methylhept-2-enoate.
| Compound Name | ethyl (5S)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-5-(hydroxymethyl)-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 91258947 |
| Molecular Formula | C27H32ClFO6 |
| Molecular Weight | 507.00 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | ethyl (5S)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-5-(hydroxymethyl)-6-methylhept-2-enoate |
| SMILES | CCOC(=O)C(=CC[C@H](CO)C(C)C)C(=O)c1cc(Cc2cccc(Cl)c2F)c(OC)cc1OC |
| InChI | InChI=1S/C27H32ClFO6/c1-6-35-27(32)20(11-10-18(15-30)16(2)3)26(31)21-13-19(23(33-4)14-24(21)34-5)12-17-8-7-9-22(28)25(17)29/h7-9,11,13-14,16,18,30H,6,10,12,15H2,1-5H3/t18-/m1/s1 |
| InChIKey | DSFORDNHMCLOLZ-GOSISDBHSA-N |
| XLogP | 5.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|