C21H20ClF2NO5 — CID 143778385
fluoro (Z)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-3-(dimethylamino)prop-2-enoate (PubChem CID 143778385) has the molecular formula C21H20ClF2NO5 and a molecular weight of 439.84 g/mol. Its IUPAC name is fluoro (Z)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-3-(dimethylamino)prop-2-enoate.
| Compound Name | fluoro (Z)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-3-(dimethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 143778385 |
| Molecular Formula | C21H20ClF2NO5 |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | fluoro (Z)-2-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl]-3-(dimethylamino)prop-2-enoate |
| SMILES | COc1cc(OC)c(C(=O)/C(=C/N(C)C)C(=O)OF)cc1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C21H20ClF2NO5/c1-25(2)11-15(21(27)30-24)20(26)14-9-13(17(28-3)10-18(14)29-4)8-12-6-5-7-16(22)19(12)23/h5-7,9-11H,8H2,1-4H3/b15-11- |
| InChIKey | XKLOYECWMVMOQM-PTNGSMBKSA-N |
| XLogP | 4.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|