C25H28ClF2NO5 — CID 135974833
ethyl (Z)-3-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate (PubChem CID 135974833) has the molecular formula C25H28ClF2NO5 and a molecular weight of 495.95 g/mol. Its IUPAC name is ethyl (Z)-3-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 135974833 |
| Molecular Formula | C25H28ClF2NO5 |
| Molecular Weight | 495.95 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | ethyl (Z)-3-[5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-methoxyphenyl]-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](CO)C(C)C)=C(\O)c1cc(Cc2cccc(Cl)c2F)c(OC)cc1F |
| InChI | InChI=1S/C25H28ClF2NO5/c1-5-34-25(32)18(12-29-21(13-30)14(2)3)24(31)17-10-16(22(33-4)11-20(17)27)9-15-7-6-8-19(26)23(15)28/h6-8,10-12,14,21,30-31H,5,9,13H2,1-4H3/b24-18-,29-12+/t21-/m1/s1 |
| InChIKey | TUTGPYKUYQNREN-ATHVHXMFSA-N |
| XLogP | 5.14 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|