C25H29ClFNO5 — CID 59551828
(2E)-1-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione (PubChem CID 59551828) has the molecular formula C25H29ClFNO5 and a molecular weight of 477.96 g/mol. Its IUPAC name is (2E)-1-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione.
| Compound Name | (2E)-1-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 59551828 |
| Molecular Formula | C25H29ClFNO5 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (2E)-1-[5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxyphenyl]-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione |
| SMILES | COc1cc(OC)c(C(=O)/C(=C/N[C@H](CO)C(C)C)C(C)=O)cc1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C25H29ClFNO5/c1-14(2)21(13-29)28-12-19(15(3)30)25(31)18-10-17(22(32-4)11-23(18)33-5)9-16-7-6-8-20(26)24(16)27/h6-8,10-12,14,21,28-29H,9,13H2,1-5H3/b19-12+/t21-/m1/s1 |
| InChIKey | BBHLDVJFJJTWLA-PRWBYUBPSA-N |
| XLogP | 4.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|