C20H29NO4 — CID 70948197
1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(3R)-2-methylpentan-3-yl]amino]methylidene]butane-1,3-dione (PubChem CID 70948197) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(3R)-2-methylpentan-3-yl]amino]methylidene]butane-1,3-dione.
| Compound Name | 1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(3R)-2-methylpentan-3-yl]amino]methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 70948197 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(3R)-2-methylpentan-3-yl]amino]methylidene]butane-1,3-dione |
| SMILES | CC[C@@H](NC=C(C(C)=O)C(=O)c1cc(C)c(OC)cc1OC)C(C)C |
| InChI | InChI=1S/C20H29NO4/c1-8-17(12(2)3)21-11-16(14(5)22)20(23)15-9-13(4)18(24-6)10-19(15)25-7/h9-12,17,21H,8H2,1-7H3/t17-/m1/s1 |
| InChIKey | VVRSQNPWNAPQDA-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|