C20H29NO4 — CID 153125397
4-(2,4-dimethoxy-5-methylphenyl)-4-hydroxy-3-[[(3R)-2-methylpentan-3-yl]iminomethyl]but-3-en-2-one (PubChem CID 153125397) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-(2,4-dimethoxy-5-methylphenyl)-4-hydroxy-3-[[(3R)-2-methylpentan-3-yl]iminomethyl]but-3-en-2-one.
| Compound Name | 4-(2,4-dimethoxy-5-methylphenyl)-4-hydroxy-3-[[(3R)-2-methylpentan-3-yl]iminomethyl]but-3-en-2-one |
|---|---|
| PubChem CID | 153125397 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-(2,4-dimethoxy-5-methylphenyl)-4-hydroxy-3-[[(3R)-2-methylpentan-3-yl]iminomethyl]but-3-en-2-one |
| SMILES | CC[C@@H](/N=C/C(C(C)=O)=C(O)c1cc(C)c(OC)cc1OC)C(C)C |
| InChI | InChI=1S/C20H29NO4/c1-8-17(12(2)3)21-11-16(14(5)22)20(23)15-9-13(4)18(24-6)10-19(15)25-7/h9-12,17,23H,8H2,1-7H3/b20-16?,21-11+/t17-/m1/s1 |
| InChIKey | MQOIJALHSUGAPH-OROFPDDZSA-N |
| XLogP | 4.38 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|