C23H27NO5 — CID 166436997
ethyl (Z)-3-(2,5-dimethoxyphenyl)-3-hydroxy-2-[(2,4,6-trimethylphenyl)iminomethyl]prop-2-enoate (PubChem CID 166436997) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl (Z)-3-(2,5-dimethoxyphenyl)-3-hydroxy-2-[(2,4,6-trimethylphenyl)iminomethyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,5-dimethoxyphenyl)-3-hydroxy-2-[(2,4,6-trimethylphenyl)iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 166436997 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | ethyl (Z)-3-(2,5-dimethoxyphenyl)-3-hydroxy-2-[(2,4,6-trimethylphenyl)iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1c(C)cc(C)cc1C)=C(\O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H27NO5/c1-7-29-23(26)19(13-24-21-15(3)10-14(2)11-16(21)4)22(25)18-12-17(27-5)8-9-20(18)28-6/h8-13,25H,7H2,1-6H3/b22-19-,24-13+ |
| InChIKey | FHSAOQXUSMLHAR-YYYHUXCNSA-N |
| XLogP | 4.86 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|