C19H27NO5 — CID 58019116
(2E)-1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione (PubChem CID 58019116) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2E)-1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione.
| Compound Name | (2E)-1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 58019116 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (2E)-1-(2,4-dimethoxy-5-methylphenyl)-2-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methylidene]butane-1,3-dione |
| SMILES | COc1cc(OC)c(C(=O)/C(=C/N[C@H](CO)C(C)C)C(C)=O)cc1C |
| InChI | InChI=1S/C19H27NO5/c1-11(2)16(10-21)20-9-15(13(4)22)19(23)14-7-12(3)17(24-5)8-18(14)25-6/h7-9,11,16,20-21H,10H2,1-6H3/b15-9+/t16-/m1/s1 |
| InChIKey | MQQRBCZQOZZWQU-HTRKUNOGSA-N |
| XLogP | 2.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|