C16H13Cl2FO3 — CID 24809695
5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl chloride (PubChem CID 24809695) has the molecular formula C16H13Cl2FO3 and a molecular weight of 343.18 g/mol. Its IUPAC name is 5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl chloride.
| Compound Name | 5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl chloride |
|---|---|
| PubChem CID | 24809695 |
| Molecular Formula | C16H13Cl2FO3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoyl chloride |
| SMILES | COc1cc(OC)c(C(=O)Cl)cc1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C16H13Cl2FO3/c1-21-13-8-14(22-2)11(16(18)20)7-10(13)6-9-4-3-5-12(17)15(9)19/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | KYILDQFSFGWIJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|