C14H8Cl2F2O2 — CID 89228369
5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-hydroxybenzoyl chloride (PubChem CID 89228369) has the molecular formula C14H8Cl2F2O2 and a molecular weight of 317.12 g/mol. Its IUPAC name is 5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-hydroxybenzoyl chloride.
| Compound Name | 5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-hydroxybenzoyl chloride |
|---|---|
| PubChem CID | 89228369 |
| Molecular Formula | C14H8Cl2F2O2 |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 5-[(3-chloro-2-fluorophenyl)methyl]-2-fluoro-4-hydroxybenzoyl chloride |
| SMILES | O=C(Cl)c1cc(Cc2cccc(Cl)c2F)c(O)cc1F |
| InChI | InChI=1S/C14H8Cl2F2O2/c15-10-3-1-2-7(13(10)18)4-8-5-9(14(16)20)11(17)6-12(8)19/h1-3,5-6,19H,4H2 |
| InChIKey | VUPNUFAVEKNMJU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|