C14H10ClF3N2O — CID 114487296
5-[(3-chloro-2-fluorophenyl)methylamino]-2,4-difluorobenzamide (PubChem CID 114487296) has the molecular formula C14H10ClF3N2O and a molecular weight of 314.69 g/mol. Its IUPAC name is 5-[(3-chloro-2-fluorophenyl)methylamino]-2,4-difluorobenzamide.
| Compound Name | 5-[(3-chloro-2-fluorophenyl)methylamino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 114487296 |
| Molecular Formula | C14H10ClF3N2O |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-[(3-chloro-2-fluorophenyl)methylamino]-2,4-difluorobenzamide |
| SMILES | NC(=O)c1cc(NCc2cccc(Cl)c2F)c(F)cc1F |
| InChI | InChI=1S/C14H10ClF3N2O/c15-9-3-1-2-7(13(9)18)6-20-12-4-8(14(19)21)10(16)5-11(12)17/h1-5,20H,6H2,(H2,19,21) |
| InChIKey | HVIDXVBYESLXQS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |