C14H11ClF2N2O — CID 43673715
5-[(4-chlorophenyl)methylamino]-2,4-difluorobenzamide (PubChem CID 43673715) has the molecular formula C14H11ClF2N2O and a molecular weight of 296.70 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylamino]-2,4-difluorobenzamide.
| Compound Name | 5-[(4-chlorophenyl)methylamino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 43673715 |
| Molecular Formula | C14H11ClF2N2O |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-[(4-chlorophenyl)methylamino]-2,4-difluorobenzamide |
| SMILES | NC(=O)c1cc(NCc2ccc(Cl)cc2)c(F)cc1F |
| InChI | InChI=1S/C14H11ClF2N2O/c15-9-3-1-8(2-4-9)7-19-13-5-10(14(18)20)11(16)6-12(13)17/h1-6,19H,7H2,(H2,18,20) |
| InChIKey | QPVBKYLFZKSLIY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |