C13H18F2N2O — CID 62964464
5-(3,3-dimethylbutylamino)-2,4-difluorobenzamide (PubChem CID 62964464) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 5-(3,3-dimethylbutylamino)-2,4-difluorobenzamide.
| Compound Name | 5-(3,3-dimethylbutylamino)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 62964464 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-(3,3-dimethylbutylamino)-2,4-difluorobenzamide |
| SMILES | CC(C)(C)CCNc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-13(2,3)4-5-17-11-6-8(12(16)18)9(14)7-10(11)15/h6-7,17H,4-5H2,1-3H3,(H2,16,18) |
| InChIKey | QRMIYFJIQQNEDZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |