C13H17F2N3O2 — CID 61155996
5-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,4-difluorobenzamide (PubChem CID 61155996) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 5-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,4-difluorobenzamide.
| Compound Name | 5-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61155996 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-2,4-difluorobenzamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C13H17F2N3O2/c1-13(2,3)10(16)12(20)18-9-4-6(11(17)19)7(14)5-8(9)15/h4-5,10H,16H2,1-3H3,(H2,17,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | AJMAOYPNJYPIOY-SNVBAGLBSA-N |
| XLogP | 1.38 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |