C11H11F2N3O4 — CID 64897236
3-amino-4-(5-carbamoyl-2,4-difluoroanilino)-4-oxobutanoic acid (PubChem CID 64897236) has the molecular formula C11H11F2N3O4 and a molecular weight of 287.22 g/mol. Its IUPAC name is 3-amino-4-(5-carbamoyl-2,4-difluoroanilino)-4-oxobutanoic acid.
| Compound Name | 3-amino-4-(5-carbamoyl-2,4-difluoroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64897236 |
| Molecular Formula | C11H11F2N3O4 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-amino-4-(5-carbamoyl-2,4-difluoroanilino)-4-oxobutanoic acid |
| SMILES | NC(=O)c1cc(NC(=O)C(N)CC(=O)O)c(F)cc1F |
| InChI | InChI=1S/C11H11F2N3O4/c12-5-2-6(13)8(1-4(5)10(15)19)16-11(20)7(14)3-9(17)18/h1-2,7H,3,14H2,(H2,15,19)(H,16,20)(H,17,18) |
| InChIKey | OXHGZSSPKDQWGY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |