C13H17F2N3O2 — CID 82848894
5-(5-aminohexanoylamino)-2,4-difluorobenzamide (PubChem CID 82848894) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 5-(5-aminohexanoylamino)-2,4-difluorobenzamide.
| Compound Name | 5-(5-aminohexanoylamino)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 82848894 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-(5-aminohexanoylamino)-2,4-difluorobenzamide |
| SMILES | CC(N)CCCC(=O)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C13H17F2N3O2/c1-7(16)3-2-4-12(19)18-11-5-8(13(17)20)9(14)6-10(11)15/h5-7H,2-4,16H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | DORAUMLRAIHPLY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |