C14H20F2N2O — CID 43673685
2,4-difluoro-5-(heptan-2-ylamino)benzamide (PubChem CID 43673685) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 2,4-difluoro-5-(heptan-2-ylamino)benzamide.
| Compound Name | 2,4-difluoro-5-(heptan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 43673685 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2,4-difluoro-5-(heptan-2-ylamino)benzamide |
| SMILES | CCCCCC(C)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-3-4-5-6-9(2)18-13-7-10(14(17)19)11(15)8-12(13)16/h7-9,18H,3-6H2,1-2H3,(H2,17,19) |
| InChIKey | IXWUERSNMYGAHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|