C16H24F2N2O — CID 155520957
2,6-difluoro-3-(nonan-2-ylamino)benzamide (PubChem CID 155520957) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,6-difluoro-3-(nonan-2-ylamino)benzamide.
| Compound Name | 2,6-difluoro-3-(nonan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 155520957 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2,6-difluoro-3-(nonan-2-ylamino)benzamide |
| SMILES | CCCCCCCC(C)Nc1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C16H24F2N2O/c1-3-4-5-6-7-8-11(2)20-13-10-9-12(17)14(15(13)18)16(19)21/h9-11,20H,3-8H2,1-2H3,(H2,19,21) |
| InChIKey | YSBOSWBIKUCEGJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|