C12H14F2N2O3 — CID 115352435
methyl 2-(5-carbamoyl-2,4-difluoroanilino)butanoate (PubChem CID 115352435) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is methyl 2-(5-carbamoyl-2,4-difluoroanilino)butanoate.
| Compound Name | methyl 2-(5-carbamoyl-2,4-difluoroanilino)butanoate |
|---|---|
| PubChem CID | 115352435 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl 2-(5-carbamoyl-2,4-difluoroanilino)butanoate |
| SMILES | CCC(Nc1cc(C(N)=O)c(F)cc1F)C(=O)OC |
| InChI | InChI=1S/C12H14F2N2O3/c1-3-9(12(18)19-2)16-10-4-6(11(15)17)7(13)5-8(10)14/h4-5,9,16H,3H2,1-2H3,(H2,15,17) |
| InChIKey | ZRPUJADEFUCDHC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |