C11H10F2N2O2 — CID 78952252
5-(but-2-enoylamino)-2,4-difluorobenzamide (PubChem CID 78952252) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 5-(but-2-enoylamino)-2,4-difluorobenzamide.
| Compound Name | 5-(but-2-enoylamino)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 78952252 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-(but-2-enoylamino)-2,4-difluorobenzamide |
| SMILES | CC=CC(=O)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C11H10F2N2O2/c1-2-3-10(16)15-9-4-6(11(14)17)7(12)5-8(9)13/h2-5H,1H3,(H2,14,17)(H,15,16) |
| InChIKey | YXAFHAWSUOGGKT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|