C7H7F2N3O3S — CID 112573250
2,4-difluoro-5-(sulfamoylamino)benzamide (PubChem CID 112573250) has the molecular formula C7H7F2N3O3S and a molecular weight of 251.21 g/mol. Its IUPAC name is 2,4-difluoro-5-(sulfamoylamino)benzamide.
| Compound Name | 2,4-difluoro-5-(sulfamoylamino)benzamide |
|---|---|
| PubChem CID | 112573250 |
| Molecular Formula | C7H7F2N3O3S |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2,4-difluoro-5-(sulfamoylamino)benzamide |
| SMILES | NC(=O)c1cc(NS(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C7H7F2N3O3S/c8-4-2-5(9)6(12-16(11,14)15)1-3(4)7(10)13/h1-2,12H,(H2,10,13)(H2,11,14,15) |
| InChIKey | RLXAVWCNFMGUEZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |